C18H17BrClF — CID 114857930
5-bromo-6-[(4-chloro-2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 114857930) has the molecular formula C18H17BrClF and a molecular weight of 367.69 g/mol. Its IUPAC name is 5-bromo-6-[(4-chloro-2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-6-[(4-chloro-2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 114857930 |
| Molecular Formula | C18H17BrClF |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-bromo-6-[(4-chloro-2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Fc1cc(Cl)ccc1CC1CCCc2ccccc2C1Br |
| InChI | InChI=1S/C18H17BrClF/c19-18-14(10-13-8-9-15(20)11-17(13)21)6-3-5-12-4-1-2-7-16(12)18/h1-2,4,7-9,11,14,18H,3,5-6,10H2 |
| InChIKey | OFCHLWAVRPDLTJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|