C18H17Br2F — CID 63470876
5-bromo-6-[(3-bromo-4-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63470876) has the molecular formula C18H17Br2F and a molecular weight of 412.14 g/mol. Its IUPAC name is 5-bromo-6-[(3-bromo-4-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-6-[(3-bromo-4-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63470876 |
| Molecular Formula | C18H17Br2F |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 5-bromo-6-[(3-bromo-4-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Fc1ccc(CC2CCCc3ccccc3C2Br)cc1Br |
| InChI | InChI=1S/C18H17Br2F/c19-16-11-12(8-9-17(16)21)10-14-6-3-5-13-4-1-2-7-15(13)18(14)20/h1-2,4,7-9,11,14,18H,3,5-6,10H2 |
| InChIKey | CWSAPWNRYKWYQN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|