C13H15Br2F — CID 64907534
2-bromo-4-[(3-bromo-2-methylcyclopentyl)methyl]-1-fluorobenzene (PubChem CID 64907534) has the molecular formula C13H15Br2F and a molecular weight of 350.07 g/mol. Its IUPAC name is 2-bromo-4-[(3-bromo-2-methylcyclopentyl)methyl]-1-fluorobenzene.
| Compound Name | 2-bromo-4-[(3-bromo-2-methylcyclopentyl)methyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 64907534 |
| Molecular Formula | C13H15Br2F |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 2-bromo-4-[(3-bromo-2-methylcyclopentyl)methyl]-1-fluorobenzene |
| SMILES | CC1C(Br)CCC1Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H15Br2F/c1-8-10(3-4-11(8)14)6-9-2-5-13(16)12(15)7-9/h2,5,7-8,10-11H,3-4,6H2,1H3 |
| InChIKey | AGBMPKQCZJMEPZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|