C12H12N2S — CID 151034122
4-(1,2,3,4-tetrahydronaphthalen-1-yl)thiadiazole (PubChem CID 151034122) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydronaphthalen-1-yl)thiadiazole.
| Compound Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)thiadiazole |
|---|---|
| PubChem CID | 151034122 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)thiadiazole |
| SMILES | c1ccc2c(c1)CCCC2c1csnn1 |
| InChI | InChI=1S/C12H12N2S/c1-2-6-10-9(4-1)5-3-7-11(10)12-8-15-14-13-12/h1-2,4,6,8,11H,3,5,7H2 |
| InChIKey | MARVKMFEBBZIBD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |