C10H16N4 — CID 65422175
[6-ethyl-2-(2-methylcyclopropyl)pyrimidin-4-yl]hydrazine (PubChem CID 65422175) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is [6-ethyl-2-(2-methylcyclopropyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-ethyl-2-(2-methylcyclopropyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 65422175 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | [6-ethyl-2-(2-methylcyclopropyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1cc(NN)nc(C2CC2C)n1 |
| InChI | InChI=1S/C10H16N4/c1-3-7-5-9(14-11)13-10(12-7)8-4-6(8)2/h5-6,8H,3-4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | HXNHFMVDBBRCEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|