C20H21NO3S — CID 55590902
4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-6-ethyl-7-hydroxychromen-2-one (PubChem CID 55590902) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-6-ethyl-7-hydroxychromen-2-one.
| Compound Name | 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-6-ethyl-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 55590902 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-6-ethyl-7-hydroxychromen-2-one |
| SMILES | CCc1cc2c(CN(Cc3cccs3)C3CC3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H21NO3S/c1-2-13-8-17-14(9-20(23)24-19(17)10-18(13)22)11-21(15-5-6-15)12-16-4-3-7-25-16/h3-4,7-10,15,22H,2,5-6,11-12H2,1H3 |
| InChIKey | RIFIBSQKNGDFCF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|