C15H17NO2S2 — CID 80730218
4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80730218) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80730218 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C15H17NO2S2/c1-10-11(7-14(20-10)15(17)18)8-16(12-4-5-12)9-13-3-2-6-19-13/h2-3,6-7,12H,4-5,8-9H2,1H3,(H,17,18) |
| InChIKey | SDOOSRICIVGLFO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |