C17H19NO2S — CID 62029913
3-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-4-methoxybenzaldehyde (PubChem CID 62029913) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 62029913 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CN(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C17H19NO2S/c1-20-17-7-4-13(12-19)9-14(17)10-18(15-5-6-15)11-16-3-2-8-21-16/h2-4,7-9,12,15H,5-6,10-11H2,1H3 |
| InChIKey | ZJXBBLBLFRGXBN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|