C18H19NO3S — CID 9264226
6-ethyl-7-hydroxy-4-[(2-thiophen-2-ylethylamino)methyl]chromen-2-one (PubChem CID 9264226) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-[(2-thiophen-2-ylethylamino)methyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-[(2-thiophen-2-ylethylamino)methyl]chromen-2-one |
|---|---|
| PubChem CID | 9264226 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-[(2-thiophen-2-ylethylamino)methyl]chromen-2-one |
| SMILES | CCc1cc2c(CNCCc3cccs3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C18H19NO3S/c1-2-12-8-15-13(9-18(21)22-17(15)10-16(12)20)11-19-6-5-14-4-3-7-23-14/h3-4,7-10,19-20H,2,5-6,11H2,1H3 |
| InChIKey | FEUBLSVTKFYTBN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|