C20H22NO3S+ — CID 9446258
6-ethyl-7-hydroxy-4-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]chromen-2-one (PubChem CID 9446258) has the molecular formula C20H22NO3S+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9446258 |
| Molecular Formula | C20H22NO3S+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]chromen-2-one |
| SMILES | CCc1cc2c(C[NH+]3CCC[C@@H]3c3cccs3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H21NO3S/c1-2-13-9-15-14(10-20(23)24-18(15)11-17(13)22)12-21-7-3-5-16(21)19-6-4-8-25-19/h4,6,8-11,16,22H,2-3,5,7,12H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | USPRPZRZKQTRHN-MRXNPFEDSA-O |
| XLogP | 3.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|