C20H18N2O3 — CID 60598218
2-[4-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]acetonitrile (PubChem CID 60598218) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[4-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 60598218 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[4-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]acetonitrile |
| SMILES | CCc1cc2c(CNc3ccc(CC#N)cc3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H18N2O3/c1-2-14-9-17-15(10-20(24)25-19(17)11-18(14)23)12-22-16-5-3-13(4-6-16)7-8-21/h3-6,9-11,22-23H,2,7,12H2,1H3 |
| InChIKey | SGESBEVYEMVFIK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|