C21H21NO4S — CID 71882763
4-[[4-(methylsulfonylmethyl)anilino]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 71882763) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[[4-(methylsulfonylmethyl)anilino]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[[4-(methylsulfonylmethyl)anilino]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 71882763 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-[[4-(methylsulfonylmethyl)anilino]methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | CS(=O)(=O)Cc1ccc(NCc2cc(=O)oc3cc4c(cc23)CCC4)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-27(24,25)13-14-5-7-18(8-6-14)22-12-17-11-21(23)26-20-10-16-4-2-3-15(16)9-19(17)20/h5-11,22H,2-4,12-13H2,1H3 |
| InChIKey | HABNIHWOLCVICV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|