C21H20N2O3 — CID 91642273
2-methyl-4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylamino]benzamide (PubChem CID 91642273) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-methyl-4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylamino]benzamide.
| Compound Name | 2-methyl-4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 91642273 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-methyl-4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylamino]benzamide |
| SMILES | Cc1cc(NCc2cc(=O)oc3cc4c(cc23)CCC4)ccc1C(N)=O |
| InChI | InChI=1S/C21H20N2O3/c1-12-7-16(5-6-17(12)21(22)25)23-11-15-10-20(24)26-19-9-14-4-2-3-13(14)8-18(15)19/h5-10,23H,2-4,11H2,1H3,(H2,22,25) |
| InChIKey | RFNPUWUSRAVEDN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|