C21H17ClO5 — CID 2635190
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 5-chloro-2-methoxybenzoate (PubChem CID 2635190) has the molecular formula C21H17ClO5 and a molecular weight of 384.82 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 5-chloro-2-methoxybenzoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2635190 |
| Molecular Formula | C21H17ClO5 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C21H17ClO5/c1-25-18-6-5-15(22)10-17(18)21(24)26-11-14-9-20(23)27-19-8-13-4-2-3-12(13)7-16(14)19/h5-10H,2-4,11H2,1H3 |
| InChIKey | RCGZUUUFLAGOHB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|