C20H18N2O4 — CID 8967437
1-[4-[(7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]pyrrolidin-2-one (PubChem CID 8967437) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[4-[(7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8967437 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[4-[(7-hydroxy-2-oxochromen-4-yl)methylamino]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(NCc2cc(=O)oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C20H18N2O4/c23-16-7-8-17-13(10-20(25)26-18(17)11-16)12-21-14-3-5-15(6-4-14)22-9-1-2-19(22)24/h3-8,10-11,21,23H,1-2,9,12H2 |
| InChIKey | KRAUSLQQWIZAEN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|