C18H14ClNO3 — CID 35141061
N-benzyl-6-chloro-7-methyl-4-oxochromene-2-carboxamide (PubChem CID 35141061) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-benzyl-6-chloro-7-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-benzyl-6-chloro-7-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35141061 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-benzyl-6-chloro-7-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1cc2oc(C(=O)NCc3ccccc3)cc(=O)c2cc1Cl |
| InChI | InChI=1S/C18H14ClNO3/c1-11-7-16-13(8-14(11)19)15(21)9-17(23-16)18(22)20-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,20,22) |
| InChIKey | DXMHPAKISJQESZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |