C20H17ClN2O4 — CID 155942915
6-chloro-7-methyl-N-[2-(4-methylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide (PubChem CID 155942915) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 6-chloro-7-methyl-N-[2-(4-methylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-7-methyl-N-[2-(4-methylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 155942915 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 6-chloro-7-methyl-N-[2-(4-methylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2cc(=O)c3cc(Cl)c(C)cc3o2)cc1 |
| InChI | InChI=1S/C20H17ClN2O4/c1-11-3-5-13(6-4-11)23-19(25)10-22-20(26)18-9-16(24)14-8-15(21)12(2)7-17(14)27-18/h3-9H,10H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | RQJYQJUJFZCFOI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |