C20H18N2O4 — CID 17494612
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide (PubChem CID 17494612) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 17494612 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-oxochromene-2-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C20H18N2O4/c1-12-6-5-7-13(2)19(12)22-18(24)11-21-20(25)17-10-15(23)14-8-3-4-9-16(14)26-17/h3-10H,11H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | AHDIUPPJXQABTP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |