C15H12ClN3O3S2 — CID 4975440
6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-7-methyl-4-oxochromene-2-carboxamide (PubChem CID 4975440) has the molecular formula C15H12ClN3O3S2 and a molecular weight of 381.87 g/mol. Its IUPAC name is 6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-7-methyl-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-7-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 4975440 |
| Molecular Formula | C15H12ClN3O3S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-7-methyl-4-oxochromene-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(=O)c3cc(Cl)c(C)cc3o2)s1 |
| InChI | InChI=1S/C15H12ClN3O3S2/c1-3-23-15-19-18-14(24-15)17-13(21)12-6-10(20)8-5-9(16)7(2)4-11(8)22-12/h4-6H,3H2,1-2H3,(H,17,18,21) |
| InChIKey | KSGRSXUVIFFVCE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|