C13H16BrN3O2 — CID 9058519
(Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 9058519) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is (Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | (Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 9058519 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | CN1CCN(/N=C\c2cc3c(cc2Br)OCO3)CC1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-16-2-4-17(5-3-16)15-8-10-6-12-13(7-11(10)14)19-9-18-12/h6-8H,2-5,9H2,1H3/b15-8- |
| InChIKey | BPNVGVLTVWJASJ-NVNXTCNLSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|