C12H15Cl2N3 — CID 2343708
1-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 2343708) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 2343708 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | CN1CCN(N=Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C12H15Cl2N3/c1-16-5-7-17(8-6-16)15-9-10-3-2-4-11(13)12(10)14/h2-4,9H,5-8H2,1H3 |
| InChIKey | FIELHACJFLHHDG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|