C11H10Cl2N4 — CID 3348065
1-(2,3-dichlorophenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 3348065) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.13 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 3348065 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1nnc(C)n1N=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2N4/c1-7-15-16-8(2)17(7)14-6-9-4-3-5-10(12)11(9)13/h3-6H,1-2H3 |
| InChIKey | YITMWSLZSKVSSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|