C11H10Cl2N4S — CID 110521657
(Z)-1-(2,3-dichlorophenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 110521657) has the molecular formula C11H10Cl2N4S and a molecular weight of 301.20 g/mol. Its IUPAC name is (Z)-1-(2,3-dichlorophenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(2,3-dichlorophenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 110521657 |
| Molecular Formula | C11H10Cl2N4S |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (Z)-1-(2,3-dichlorophenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CSc1nnc(C)n1/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2N4S/c1-7-15-16-11(18-2)17(7)14-6-8-4-3-5-9(12)10(8)13/h3-6H,1-2H3/b14-6- |
| InChIKey | SUPCVQCVKMYGJD-NSIKDUERSA-N |
| XLogP | 3.50 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|