C14H9Cl2N5S — CID 6860051
4-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 6860051) has the molecular formula C14H9Cl2N5S and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6860051 |
| Molecular Formula | C14H9Cl2N5S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccnc2)n1/N=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl2N5S/c15-11-5-1-3-9(12(11)16)8-18-21-13(19-20-14(21)22)10-4-2-6-17-7-10/h1-8H,(H,20,22)/b18-8+ |
| InChIKey | ATCXQMACECSIOT-QGMBQPNBSA-N |
| XLogP | 4.19 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|