C18H12Cl2N6S — CID 6404129
4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6404129) has the molecular formula C18H12Cl2N6S and a molecular weight of 415.31 g/mol. Its IUPAC name is 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6404129 |
| Molecular Formula | C18H12Cl2N6S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 4-[(Z)-(2,3-dichlorophenyl)methylideneamino]-3-(3-phenyl-1H-pyrazol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc(-c3ccccc3)n[nH]2)n1/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H12Cl2N6S/c19-13-8-4-7-12(16(13)20)10-21-26-17(24-25-18(26)27)15-9-14(22-23-15)11-5-2-1-3-6-11/h1-10H,(H,22,23)(H,25,27)/b21-10- |
| InChIKey | ROAOSRSSEDSTJF-FBHDLOMBSA-N |
| XLogP | 5.19 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|