C18H18Cl3N3 — CID 2143721
N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2,3-dichlorophenyl)methanimine (PubChem CID 2143721) has the molecular formula C18H18Cl3N3 and a molecular weight of 382.72 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2,3-dichlorophenyl)methanimine.
| Compound Name | N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2,3-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 2143721 |
| Molecular Formula | C18H18Cl3N3 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2,3-dichlorophenyl)methanimine |
| SMILES | Clc1ccc(CN2CCN(N=Cc3cccc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H18Cl3N3/c19-16-6-4-14(5-7-16)13-23-8-10-24(11-9-23)22-12-15-2-1-3-17(20)18(15)21/h1-7,12H,8-11,13H2 |
| InChIKey | TZQYXRDSXGSWRV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|