C14H17Cl2N3O — CID 9205447
(E)-3-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide (PubChem CID 9205447) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9205447 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide |
| SMILES | CN1CCN(NC(=O)/C=C/c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-18-7-9-19(10-8-18)17-13(20)6-5-11-3-2-4-12(15)14(11)16/h2-6H,7-10H2,1H3,(H,17,20)/b6-5+ |
| InChIKey | ZIRUQUQUHUGEDN-AATRIKPKSA-N |
| XLogP | 2.29 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|