C14H18BrN3O — CID 9205098
(E)-3-(3-bromophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide (PubChem CID 9205098) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9205098 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-(4-methylpiperazin-1-yl)prop-2-enamide |
| SMILES | CN1CCN(NC(=O)/C=C/c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C14H18BrN3O/c1-17-7-9-18(10-8-17)16-14(19)6-5-12-3-2-4-13(15)11-12/h2-6,11H,7-10H2,1H3,(H,16,19)/b6-5+ |
| InChIKey | JNXBCQRKKOXUNE-AATRIKPKSA-N |
| XLogP | 1.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|