C16H19Cl2N5 — CID 9058597
(Z)-1-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 9058597) has the molecular formula C16H19Cl2N5 and a molecular weight of 352.27 g/mol. Its IUPAC name is (Z)-1-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | (Z)-1-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 9058597 |
| Molecular Formula | C16H19Cl2N5 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (Z)-1-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | Cc1nn(-c2ccccc2Cl)c(Cl)c1C=NN1CCN(C)CC1 |
| InChI | InChI=1S/C16H19Cl2N5/c1-12-13(11-19-22-9-7-21(2)8-10-22)16(18)23(20-12)15-6-4-3-5-14(15)17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | YWTJNYWPNVXHIT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|