C18H23ClN4 — CID 2407574
1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 2407574) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 2407574 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | Cc1cc(C=NN2CCN(C)CC2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4/c1-14-12-16(13-20-22-10-8-21(3)9-11-22)15(2)23(14)18-6-4-17(19)5-7-18/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | FSKOZAKNLVZSJY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|