C21H22ClN5OS — CID 1049153
N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 1049153) has the molecular formula C21H22ClN5OS and a molecular weight of 427.96 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1049153 |
| Molecular Formula | C21H22ClN5OS |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)NN=Cc2cc(C)n(-c3ccc(Cl)cc3)c2C)n1 |
| InChI | InChI=1S/C21H22ClN5OS/c1-13-9-14(2)25-21(24-13)29-12-20(28)26-23-11-17-10-15(3)27(16(17)4)19-7-5-18(22)6-8-19/h5-11H,12H2,1-4H3,(H,26,28) |
| InChIKey | IUFMQRFCNVKEDX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|