C24H27N5O3S — CID 126236552
methyl 4-[3-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate (PubChem CID 126236552) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is methyl 4-[3-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[3-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 126236552 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | methyl 4-[3-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(/C=N\NC(=O)CSc3nc(C)cc(C)n3)c2C)c(C)c1 |
| InChI | InChI=1S/C24H27N5O3S/c1-14-9-19(23(31)32-6)7-8-21(14)29-17(4)11-20(18(29)5)12-25-28-22(30)13-33-24-26-15(2)10-16(3)27-24/h7-12H,13H2,1-6H3,(H,28,30)/b25-12- |
| InChIKey | CFXYCPYYSUWEGS-ROTLSHHCSA-N |
| XLogP | 3.84 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|