C19H16Cl2N4O2S — CID 29250485
N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 29250485) has the molecular formula C19H16Cl2N4O2S and a molecular weight of 435.34 g/mol. Its IUPAC name is N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 29250485 |
| Molecular Formula | C19H16Cl2N4O2S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C\c2ccc(-c3cc(Cl)ccc3Cl)o2)n1 |
| InChI | InChI=1S/C19H16Cl2N4O2S/c1-11-7-12(2)24-19(23-11)28-10-18(26)25-22-9-14-4-6-17(27-14)15-8-13(20)3-5-16(15)21/h3-9H,10H2,1-2H3,(H,25,26)/b22-9- |
| InChIKey | JHUMCLRENPHOEM-AFPJDJCSSA-N |
| XLogP | 4.90 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|