C19H14BrCl2N3O2 — CID 126356740
2-(4-bromoanilino)-N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126356740) has the molecular formula C19H14BrCl2N3O2 and a molecular weight of 467.15 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126356740 |
| Molecular Formula | C19H14BrCl2N3O2 |
| Molecular Weight | 467.15 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Br)cc1)N/N=C\c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C19H14BrCl2N3O2/c20-12-1-4-14(5-2-12)23-11-19(26)25-24-10-15-6-8-18(27-15)16-9-13(21)3-7-17(16)22/h1-10,23H,11H2,(H,25,26)/b24-10- |
| InChIKey | WTIDOLCBCXHDSK-VROXFSQNSA-N |
| XLogP | 5.58 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|