C24H26ClN3OS — CID 92850692
2-[(4-chlorophenyl)methylsulfanyl]-N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 92850692) has the molecular formula C24H26ClN3OS and a molecular weight of 440.01 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 92850692 |
| Molecular Formula | C24H26ClN3OS |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[(Z)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(/C=N\NC(=O)CSCc3ccc(Cl)cc3)c2C)c1 |
| InChI | InChI=1S/C24H26ClN3OS/c1-16-9-17(2)11-23(10-16)28-18(3)12-21(19(28)4)13-26-27-24(29)15-30-14-20-5-7-22(25)8-6-20/h5-13H,14-15H2,1-4H3,(H,27,29)/b26-13- |
| InChIKey | NADCDOJUJRGQDC-ZMFRSBBQSA-N |
| XLogP | 5.75 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|