C22H20BrCl2N3OS — CID 98060719
2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98060719) has the molecular formula C22H20BrCl2N3OS and a molecular weight of 525.30 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98060719 |
| Molecular Formula | C22H20BrCl2N3OS |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CSCc2cccc(Br)c2)c(C)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H20BrCl2N3OS/c1-14-8-17(15(2)28(14)21-10-19(24)6-7-20(21)25)11-26-27-22(29)13-30-12-16-4-3-5-18(23)9-16/h3-11H,12-13H2,1-2H3,(H,27,29)/b26-11- |
| InChIKey | XLHFABRCTWWWTP-RAWMCFOBSA-N |
| XLogP | 6.55 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|