C16H13BrCl2N2OS — CID 2261299
2-[(3-bromophenyl)methylsulfanyl]-N-[(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 2261299) has the molecular formula C16H13BrCl2N2OS and a molecular weight of 432.17 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-[(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2261299 |
| Molecular Formula | C16H13BrCl2N2OS |
| Molecular Weight | 432.17 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CSCc1cccc(Br)c1)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13BrCl2N2OS/c17-13-3-1-2-11(6-13)9-23-10-16(22)21-20-8-12-4-5-14(18)7-15(12)19/h1-8H,9-10H2,(H,21,22) |
| InChIKey | DYQVNYLSQOWSDO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.17 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|