C22H19ClN2OS — CID 6871697
2-[(4-chlorophenyl)methylsulfanyl]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide (PubChem CID 6871697) has the molecular formula C22H19ClN2OS and a molecular weight of 394.93 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6871697 |
| Molecular Formula | C22H19ClN2OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)N/N=C/c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C22H19ClN2OS/c23-19-10-4-15(5-11-19)13-27-14-21(26)25-24-12-18-9-8-17-7-6-16-2-1-3-20(18)22(16)17/h1-5,8-12H,6-7,13-14H2,(H,25,26)/b24-12+ |
| InChIKey | NGYXOPNYNRTWBU-WYMPLXKRSA-N |
| XLogP | 4.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|