C18H15ClN4O — CID 5411858
4-chloro-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]-1-methylpyrazole-3-carboxamide (PubChem CID 5411858) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5411858 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-chloro-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(Cl)c(C(=O)N/N=C\c2ccc3c4c(cccc24)CC3)n1 |
| InChI | InChI=1S/C18H15ClN4O/c1-23-10-15(19)17(22-23)18(24)21-20-9-13-8-7-12-6-5-11-3-2-4-14(13)16(11)12/h2-4,7-10H,5-6H2,1H3,(H,21,24)/b20-9- |
| InChIKey | GEYQJEDTCQZFOG-UKWGHVSLSA-N |
| XLogP | 3.09 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|