C16H20ClN5O2 — CID 135804473
4-chloro-N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylpyrazole-3-carboxamide (PubChem CID 135804473) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135804473 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-chloro-N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylpyrazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)c2nn(C)cc2Cl)c(O)c1 |
| InChI | InChI=1S/C16H20ClN5O2/c1-4-22(5-2)12-7-6-11(14(23)8-12)9-18-19-16(24)15-13(17)10-21(3)20-15/h6-10,23H,4-5H2,1-3H3,(H,19,24)/b18-9+ |
| InChIKey | TWVSUVUIBLKXNC-GIJQJNRQSA-N |
| XLogP | 2.39 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|