C27H21ClN2O2 — CID 171981441
4-[(4-chlorophenyl)methoxy]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]benzamide (PubChem CID 171981441) has the molecular formula C27H21ClN2O2 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]benzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 171981441 |
| Molecular Formula | C27H21ClN2O2 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-N-[(E)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc2c3c(cccc13)CC2)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H21ClN2O2/c28-23-12-4-18(5-13-23)17-32-24-14-10-21(11-15-24)27(31)30-29-16-22-9-8-20-7-6-19-2-1-3-25(22)26(19)20/h1-5,8-16H,6-7,17H2,(H,30,31)/b29-16+ |
| InChIKey | XSONFIXAPJISRH-MUFRIFMGSA-N |
| XLogP | 5.93 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|