C27H21Cl2N3O3S — CID 126034470
2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide (PubChem CID 126034470) has the molecular formula C27H21Cl2N3O3S and a molecular weight of 538.46 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126034470 |
| Molecular Formula | C27H21Cl2N3O3S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-1,2-dihydroacenaphthylen-5-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1)N/N=C\c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C27H21Cl2N3O3S/c28-21-11-13-24(14-12-21)36(34,35)32(23-5-2-4-22(29)15-23)17-26(33)31-30-16-20-10-9-19-8-7-18-3-1-6-25(20)27(18)19/h1-6,9-16H,7-8,17H2,(H,31,33)/b30-16- |
| InChIKey | ISTFVMZRJFIMFS-UHBFCERESA-N |
| XLogP | 5.59 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|