C26H28ClN3O3S — CID 126124802
2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide (PubChem CID 126124802) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126124802 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-(2,3,4-trimethylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)N/N=C\c2ccc(C)c(C)c2C)S(=O)(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C26H28ClN3O3S/c1-17-7-11-24(14-19(17)3)30(34(32,33)25-12-9-23(27)10-13-25)16-26(31)29-28-15-22-8-6-18(2)20(4)21(22)5/h6-15H,16H2,1-5H3,(H,29,31)/b28-15- |
| InChIKey | NMCNISJVDURAHT-MBTHVWNTSA-N |
| XLogP | 5.23 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|