C20H23BrN4O3S — CID 126003341
2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]acetamide (PubChem CID 126003341) has the molecular formula C20H23BrN4O3S and a molecular weight of 479.40 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126003341 |
| Molecular Formula | C20H23BrN4O3S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1/C=N\NC(=O)CSCc1cccc(Br)c1 |
| InChI | InChI=1S/C20H23BrN4O3S/c1-3-24(4-2)19-9-8-18(25(27)28)11-16(19)12-22-23-20(26)14-29-13-15-6-5-7-17(21)10-15/h5-12H,3-4,13-14H2,1-2H3,(H,23,26)/b22-12- |
| InChIKey | MUFDVTDMOWNFFB-UUYOSTAYSA-N |
| XLogP | 4.59 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|