C16H13BrN3O4S- — CID 6967325
2-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 6967325) has the molecular formula C16H13BrN3O4S- and a molecular weight of 423.27 g/mol. Its IUPAC name is 2-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6967325 |
| Molecular Formula | C16H13BrN3O4S- |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 2-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | O=C(CSCc1ccccc1Br)N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H14BrN3O4S/c17-14-4-2-1-3-11(14)9-25-10-16(22)19-18-8-12-7-13(20(23)24)5-6-15(12)21/h1-8,21H,9-10H2,(H,19,22)/p-1/b18-8- |
| InChIKey | AGCLJBLHQPFQTR-LSCVHKIXSA-M |
| XLogP | 2.81 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|