C22H20Cl3N3OS — CID 126117967
N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 126117967) has the molecular formula C22H20Cl3N3OS and a molecular weight of 480.85 g/mol. Its IUPAC name is N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126117967 |
| Molecular Formula | C22H20Cl3N3OS |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)c(C)n1-c1ccccc1Cl |
| InChI | InChI=1S/C22H20Cl3N3OS/c1-14-10-16(15(2)28(14)21-9-4-3-6-20(21)25)11-26-27-22(29)13-30-12-17-18(23)7-5-8-19(17)24/h3-11H,12-13H2,1-2H3,(H,27,29)/b26-11- |
| InChIKey | DQTUGCKULJXBNO-RAWMCFOBSA-N |
| XLogP | 6.44 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|