C20H25ClN4O3 — CID 94837299
N'-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3-methoxypropyl)propanediamide (PubChem CID 94837299) has the molecular formula C20H25ClN4O3 and a molecular weight of 404.90 g/mol. Its IUPAC name is N'-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3-methoxypropyl)propanediamide.
| Compound Name | N'-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3-methoxypropyl)propanediamide |
|---|---|
| PubChem CID | 94837299 |
| Molecular Formula | C20H25ClN4O3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N'-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(3-methoxypropyl)propanediamide |
| SMILES | COCCCNC(=O)CC(=O)N/N=C/c1cc(C)n(-c2ccccc2Cl)c1C |
| InChI | InChI=1S/C20H25ClN4O3/c1-14-11-16(15(2)25(14)18-8-5-4-7-17(18)21)13-23-24-20(27)12-19(26)22-9-6-10-28-3/h4-5,7-8,11,13H,6,9-10,12H2,1-3H3,(H,22,26)(H,24,27)/b23-13+ |
| InChIKey | XTXUVRLJEHMKMI-YDZHTSKRSA-N |
| XLogP | 2.74 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|