C19H25N3O — CID 42992288
(E)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-morpholin-4-ylmethanimine (PubChem CID 42992288) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (E)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-morpholin-4-ylmethanimine.
| Compound Name | (E)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-morpholin-4-ylmethanimine |
|---|---|
| PubChem CID | 42992288 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (E)-1-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-morpholin-4-ylmethanimine |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N/N3CCOCC3)c2C)cc1C |
| InChI | InChI=1S/C19H25N3O/c1-14-5-6-19(11-15(14)2)22-16(3)12-18(17(22)4)13-20-21-7-9-23-10-8-21/h5-6,11-13H,7-10H2,1-4H3/b20-13+ |
| InChIKey | TVYQDTXMKUWKRZ-DEDYPNTBSA-N |
| XLogP | 3.38 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|