C29H31BrN4O2S — CID 126133833
(5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(3,4-dimethylphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126133833) has the molecular formula C29H31BrN4O2S and a molecular weight of 579.56 g/mol. Its IUPAC name is (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(3,4-dimethylphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(3,4-dimethylphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126133833 |
| Molecular Formula | C29H31BrN4O2S |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(3,4-dimethylphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3cc(C)n(-c4ccc(N5CCOCC5)c(Br)c4)c3C)N(C)C2=S)cc1C |
| InChI | InChI=1S/C29H31BrN4O2S/c1-18-6-7-23(14-19(18)2)34-28(35)27(31(5)29(34)37)16-22-15-20(3)33(21(22)4)24-8-9-26(25(30)17-24)32-10-12-36-13-11-32/h6-9,14-17H,10-13H2,1-5H3/b27-16- |
| InChIKey | NLXJUTVBQCOJBP-YUMHPJSZSA-N |
| XLogP | 5.91 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|