C29H31N5O4S — CID 126137726
(5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126137726) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126137726 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(C)n(-c4ccc(N5CCCC5)c([N+](=O)[O-])c4)c3C)N(C)C2=S)cc1 |
| InChI | InChI=1S/C29H31N5O4S/c1-5-38-24-11-8-22(9-12-24)33-28(35)27(30(4)29(33)39)17-21-16-19(2)32(20(21)3)23-10-13-25(26(18-23)34(36)37)31-14-6-7-15-31/h8-13,16-18H,5-7,14-15H2,1-4H3/b27-17- |
| InChIKey | ILGVDLSHLKLAIQ-PKAZHMFMSA-N |
| XLogP | 5.61 |
| TPSA | 84.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|